Compounds
| ID | Spectrum Quality | Annotated Name |
|---|
COMPOUND NPA016138
PROPERTIES
| NPAID | NPA016138 |
|---|---|
| CLUSTER ID | 216 |
| NODE ID | 203 |
| NAME | Naphthomycin F |
| FORMULA | C46H56N2O12S |
| MOLECULAR WEIGHT (Da) | 861.0230 |
| ACCURATE MASS (Da) | 860.3554 |
| ORIGIN ORGANISM TYPE | Fungus |
| ORIGIN GENUS | Agaricus |
| ORIGIN SPECIES | urinascens |
| InChIKey | PHYCYDGQUYYBOJ-MRMPJBOISA-N |
| InChI | InChI=1S/C46H56N2O12S/c1-23-13-11-10-12-14-26(4)45(58)48-38-42(56)32-20-29(7)41(55)37(36(32)43(57)44(38)61-22-33(46(59)60-9)47-30(8)49)40(54)28(6)19-27(5)39(53)25(3)16-18-31(50)17-15-24(2)35(52)21-34(23)51/h10-16,18-20,23,25,27,31,33-34,39,50-51,53,55H,17,21-22H2,1-9H3,(H,47,49)(H,48,58)/b12-10-,13-11+,18-16+,24-15+,26-14-,28-19+/t23-,25-,27-,31-,33-,34-,39-/m0/s1 |
| SMILES | C[C@H]1/C=C/C=C\C=C(/C(=O)NC2=C(C(=O)C3=C(C(=C(C=C3C2=O)C)O)C(=O)/C(=C/[C@@H]([C@H]([C@H](/C=C/[C@H](C/C=C(/C(=O)C[C@@H]1O)\C)O)C)O)C)/C)SC[C@@H](C(=O)OC)NC(=O)C)\C |
ORIGINAL ISOLATION REFERENCE
| CITATION | Michael Meyer Walter Keller‐Schierlein Salva Megahed Hans Zähner Annalaura Segre Metabolites of microorganisms. 236. Sulfur-containing ansa compounds of the naphthomycin type Helvetica Chimica Acta 1986 69 1356-1364. | ||
|---|---|---|---|
| DOI | 10.1002/hlca.19860690610 | PMID | - |
