Compounds
| ID | Spectrum Quality | Annotated Name |
|---|
COMPOUND NPA008263
PROPERTIES
| NPAID | NPA008263 |
|---|---|
| CLUSTER ID | 3561 |
| NODE ID | 2681 |
| NAME | Lactone II |
| FORMULA | C11H14O6 |
| MOLECULAR WEIGHT (Da) | 242.2270 |
| ACCURATE MASS (Da) | 242.0790 |
| ORIGIN ORGANISM TYPE | Bacterium |
| ORIGIN GENUS | Streptomyces |
| ORIGIN SPECIES | sp. |
| InChIKey | MDZROSJVVHMKCB-VHSKBXSJSA-N |
| InChI | InChI=1S/C11H14O6/c1-6-8(17-6)2-3-9(12)15-4-7-5-16-11(14)10(7)13/h2-3,6-8,10,13H,4-5H2,1H3/b3-2+/t6-,7-,8+,10-/m0/s1 |
| SMILES | C[C@H]1[C@H](O1)/C=C/C(=O)OC[C@H]2COC(=O)[C@H]2O |
ORIGINAL ISOLATION REFERENCE
| CITATION | Schiewe, Hans-Joerg; Zeeck, Axel Cineromycins, γ-butyrolactones and ansamycins by analysis of the secondary metabolite pattern created by a single strain of Streptomyces Journal of Antibiotics 1999 52 (7) 635-642. | ||
|---|---|---|---|
| DOI | 10.7164/antibiotics.52.635 | PMID | 10513843 |
