Compounds
| ID | Spectrum Quality | Annotated Name |
|---|---|---|
| CCMSLIB00000578116 | Gold | 5'-METHYLTHIOADENOSINE |
| CCMSLIB00000577895 | Gold | 5'-METHYLTHIOADENOSINE |
| CCMSLIB00000217943 | Bronze | Massbank:KO002721&5'-Deoxy-5'-Methylthioadenosine|5'-Deoxy-5'-(methylthio)adenosine|MTA|5-Methylthioadenosine|Thiomethyladenosine|S-Methyl-5'-thioadenosine|Methylthioadenosine|5'-Methylthioadenosine |
| CCMSLIB00000217945 | Bronze | Massbank:KO002722&5'-Deoxy-5'-Methylthioadenosine|5'-Deoxy-5'-(methylthio)adenosine|MTA|5-Methylthioadenosine|Thiomethyladenosine|S-Methyl-5'-thioadenosine|Methylthioadenosine|5'-Methylthioadenosine |
| CCMSLIB00000217947 | Bronze | Massbank:KO002723&5'-Deoxy-5'-Methylthioadenosine|5'-Deoxy-5'-(methylthio)adenosine|MTA|5-Methylthioadenosine|Thiomethyladenosine|S-Methyl-5'-thioadenosine|Methylthioadenosine|5'-Methylthioadenosine |
| CCMSLIB00000217949 | Bronze | Massbank:KO002724&5'-Deoxy-5'-Methylthioadenosine|5'-Deoxy-5'-(methylthio)adenosine|MTA|5-Methylthioadenosine|Thiomethyladenosine|S-Methyl-5'-thioadenosine|Methylthioadenosine|5'-Methylthioadenosine |
| CCMSLIB00000217951 | Bronze | Massbank:KO002725&5'-Deoxy-5'-Methylthioadenosine|5'-Deoxy-5'-(methylthio)adenosine|MTA|5-Methylthioadenosine|Thiomethyladenosine|S-Methyl-5'-thioadenosine|Methylthioadenosine|5'-Methylthioadenosine |
| CCMSLIB00000221184 | Bronze | Massbank:KO008945&5'-Deoxy-5'-Methylthioadenosine|5'-Methylthioadenosine|5-Methylthioadenosine|MTA|Methylthioadenosine|S-Methyl-5'-thioadenosine|Thiomethyladenosine |
| CCMSLIB00000223137 | Bronze | Massbank:PR100311&5'-S-Methylthioadenosine|5'-Deoxy-5'-Methylthioadenosine|MTA|Vitamin&L2|Thiomethyladenosine|5-Methylthioadenosine |
| CCMSLIB00000563641 | Bronze | MoNA:2457408&5'-Deoxy-5'-(methylthio)adenosine |
| CCMSLIB00000216902 | Bronze | ReSpect:PS067501&5'-Deoxy-5'-Methylthioadenosine|MTA|Vitamin&L2|Thiomethyladenosine|5-Methylthioadenosine |
| CCMSLIB00000216904 | Bronze | ReSpect:PS067502&5'-Deoxy-5'-Methylthioadenosine|MTA|Vitamin&L2|Thiomethyladenosine|5-Methylthioadenosine |
| CCMSLIB00000216906 | Bronze | ReSpect:PS067503&5'-Deoxy-5'-Methylthioadenosine|MTA|Vitamin&L2|Thiomethyladenosine|5-Methylthioadenosine |
| CCMSLIB00000216908 | Bronze | ReSpect:PS067504&5'-Deoxy-5'-Methylthioadenosine|MTA|Vitamin&L2|Thiomethyladenosine|5-Methylthioadenosine |
| CCMSLIB00000216910 | Bronze | ReSpect:PS067505&5'-Deoxy-5'-Methylthioadenosine|MTA|Vitamin&L2|Thiomethyladenosine|5-Methylthioadenosine |
| CCMSLIB00000216912 | Bronze | ReSpect:PS067506&5'-Deoxy-5'-Methylthioadenosine|MTA|Vitamin&L2|Thiomethyladenosine|5-Methylthioadenosine |
| CCMSLIB00000221322 | Bronze | ReSpect:PT106750&5'-Deoxy-5'-Methylthioadenosine|MTA|Vitamin&L2|Thiomethyladenosine|5-Methylthioadenosine|(2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-(methylsulfanylmethyl)oxolane-3,4-diol |
| CCMSLIB00000222264 | Bronze | ReSpect:PT206750&5'-Deoxy-5'-Methylthioadenosine|MTA|Vitamin&L2|Thiomethyladenosine|5-Methylthioadenosine|(2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-(methylsulfanylmethyl)oxolane-3,4-diol |
| CCMSLIB00000425119 | Bronze | HMDB:HMDB01173-1448&5'-Methylthioadenosine |
| CCMSLIB00000426074 | Bronze | HMDB:HMDB01173-1450&5'-Methylthioadenosine |
| CCMSLIB00000426478 | Bronze | HMDB:HMDB01173-1449&5'-Methylthioadenosine |
| CCMSLIB00005720332 | Gold | 1 |
| CCMSLIB00006679873 | Gold | 3 |
| CCMSLIB00006679936 | Gold | 3 |
| CCMSLIB00006684287 | Gold | 3 |
| CCMSLIB00006684504 | Gold | 3 |
| CCMSLIB00006684689 | Gold | 3 |
| CCMSLIB00006684740 | Gold | 3 |
| CCMSLIB00006684753 | Gold | 3 |
| CCMSLIB00006684896 | Gold | 3 |
| CCMSLIB00005883730 | Gold | 1 |
| CCMSLIB00005883731 | Gold | 1 |
| CCMSLIB00005883732 | Gold | 1 |
| CCMSLIB00005883733 | Gold | 1 |
| CCMSLIB00005883734 | Gold | 1 |
| CCMSLIB00005883735 | Gold | 1 |
| CCMSLIB00005755283 | Gold | 3 |
| CCMSLIB00005749750 | Gold | 3 |
| CCMSLIB00005746499 | Gold | 3 |
| CCMSLIB00005756119 | Gold | 3 |
| CCMSLIB00005757791 | Gold | 3 |
| CCMSLIB00005755411 | Gold | 3 |
| CCMSLIB00005757992 | Gold | 3 |
| CCMSLIB00005756984 | Gold | 3 |
| CCMSLIB00005756417 | Gold | 3 |
| CCMSLIB00005759609 | Gold | 3 |
| CCMSLIB00005755501 | Gold | 3 |
| CCMSLIB00010108090 | Gold | 3 |
| CCMSLIB00010108091 | Gold | 3 |
| CCMSLIB00010108092 | Gold | 3 |
| CCMSLIB00010119425 | Gold | 3 |
| CCMSLIB00010119426 | Gold | 3 |
| CCMSLIB00010119427 | Gold | 3 |
| CCMSLIB00010102526 | Gold | 3 |
| CCMSLIB00010102527 | Gold | 3 |
| CCMSLIB00010102983 | Gold | 3 |
| CCMSLIB00010108313 | Gold | 3 |
| CCMSLIB00010108314 | Gold | 3 |
| CCMSLIB00010108315 | Gold | 3 |
| CCMSLIB00010108316 | Gold | 3 |
| CCMSLIB00010126141 | Gold | 3 |
| CCMSLIB00010126142 | Gold | 3 |
| CCMSLIB00010126598 | Gold | 3 |
| CCMSLIB00010119651 | Gold | 3 |
| CCMSLIB00010119652 | Gold | 3 |
| CCMSLIB00010119653 | Gold | 3 |
| CCMSLIB00010119654 | Gold | 3 |
| CCMSLIB00000853965 | Gold | 1!CCMSLIB00005464312 |
| CCMSLIB00000211969 | Gold | 3 |
| CCMSLIB00003134494 | Gold | 3 |
| CCMSLIB00003135392 | Gold | 3 |
| CCMSLIB00012112847 | Gold | 4 |
| CCMSLIB00012112848 | Gold | 4 |
| CCMSLIB00012112849 | Gold | 4 |
| CCMSLIB00009952644 | Gold | 4 |
| CCMSLIB00009952645 | Gold | 4 |
| CCMSLIB00009952646 | Gold | 4 |
| CCMSLIB00012130363 | Gold | 4 |
| CCMSLIB00012130364 | Gold | 4 |
| CCMSLIB00012130374 | Gold | 4 |
| CCMSLIB00012130376 | Gold | 4 |
| CCMSLIB00012130367 | Gold | 4 |
| CCMSLIB00012130370 | Gold | 4 |
| CCMSLIB00012130375 | Gold | 4 |
| CCMSLIB00012130362 | Gold | 4 |
| CCMSLIB00012130373 | Gold | 4 |
| CCMSLIB00012130369 | Gold | 4 |
| CCMSLIB00012130372 | Gold | 4 |
| CCMSLIB00012130380 | Gold | 4 |
| CCMSLIB00012130377 | Gold | 4 |
| CCMSLIB00012130365 | Gold | 4 |
| CCMSLIB00012130368 | Gold | 4 |
| CCMSLIB00012130366 | Gold | 4 |
| CCMSLIB00012130378 | Gold | 4 |
| CCMSLIB00012130379 | Gold | 4 |
| CCMSLIB00012130371 | Gold | 4 |
| CCMSLIB00009970160 | Gold | 4 |
| CCMSLIB00009970161 | Gold | 4 |
| CCMSLIB00009970171 | Gold | 4 |
| CCMSLIB00009970173 | Gold | 4 |
| CCMSLIB00009970164 | Gold | 4 |
| CCMSLIB00009970167 | Gold | 4 |
| CCMSLIB00009970172 | Gold | 4 |
| CCMSLIB00009970159 | Gold | 4 |
| CCMSLIB00009970170 | Gold | 4 |
| CCMSLIB00009970166 | Gold | 4 |
| CCMSLIB00009970169 | Gold | 4 |
| CCMSLIB00009970177 | Gold | 4 |
| CCMSLIB00009970174 | Gold | 4 |
| CCMSLIB00009970162 | Gold | 4 |
| CCMSLIB00009970165 | Gold | 4 |
| CCMSLIB00009970163 | Gold | 4 |
| CCMSLIB00009970175 | Gold | 4 |
| CCMSLIB00009970176 | Gold | 4 |
| CCMSLIB00009970168 | Gold | 4 |
COMPOUND NPA008075
PROPERTIES
| NPAID | NPA008075 |
|---|---|
| CLUSTER ID | 788 |
| NODE ID | 36 |
| NAME | 5'-Deoxy-5'-methylthioadenosine |
| FORMULA | C11H15N5O3S |
| MOLECULAR WEIGHT (Da) | 297.3400 |
| ACCURATE MASS (Da) | 297.0896 |
| ORIGIN ORGANISM TYPE | Fungus |
| ORIGIN GENUS | Unknown-fungus |
| ORIGIN SPECIES | sp. |
| InChIKey | WUUGFSXJNOTRMR-IOSLPCCCSA-N |
| InChI | InChI=1S/C11H15N5O3S/c1-20-2-5-7(17)8(18)11(19-5)16-4-15-6-9(12)13-3-14-10(6)16/h3-5,7-8,11,17-18H,2H2,1H3,(H2,12,13,14)/t5-,7-,8-,11-/m1/s1 |
| SMILES | CSC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C2N=CN=C3N)O)O |
ORIGINAL ISOLATION REFERENCE
| CITATION | Baddiley, J 300. Adenine 5′-deoxy-5′-methylthiopentoside (adenine thiomethyl pentoside): a proof of structure and synthesis Journal of the Chemical Society 1951 1348-1351. | ||
|---|---|---|---|
| DOI | 10.1039/jr9510001348 | PMID | - |
